C8H4FNOS — CID 82408642
7-fluoro-1,3-benzothiazole-2-carbaldehyde (PubChem CID 82408642) has the molecular formula C8H4FNOS and a molecular weight of 181.19 g/mol. Its IUPAC name is 7-fluoro-1,3-benzothiazole-2-carbaldehyde.
| Compound Name | 7-fluoro-1,3-benzothiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 82408642 |
| Molecular Formula | C8H4FNOS |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 7-fluoro-1,3-benzothiazole-2-carbaldehyde |
| SMILES | O=Cc1nc2cccc(F)c2s1 |
| InChI | InChI=1S/C8H4FNOS/c9-5-2-1-3-6-8(5)12-7(4-11)10-6/h1-4H |
| InChIKey | FROUTQVGDBLQRG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|