C9H7F2NOS — CID 118837468
2-(difluoromethyl)-7-methoxy-1,3-benzothiazole (PubChem CID 118837468) has the molecular formula C9H7F2NOS and a molecular weight of 215.22 g/mol. Its IUPAC name is 2-(difluoromethyl)-7-methoxy-1,3-benzothiazole.
| Compound Name | 2-(difluoromethyl)-7-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 118837468 |
| Molecular Formula | C9H7F2NOS |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 2-(difluoromethyl)-7-methoxy-1,3-benzothiazole |
| SMILES | COc1cccc2nc(C(F)F)sc12 |
| InChI | InChI=1S/C9H7F2NOS/c1-13-6-4-2-3-5-7(6)14-9(12-5)8(10)11/h2-4,8H,1H3 |
| InChIKey | FVTVKJOUFDNAAZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |