C10H12N2OS2 — CID 18327053
N-[(7-methoxy-1,3-benzothiazol-2-yl)sulfanyl]ethanamine (PubChem CID 18327053) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[(7-methoxy-1,3-benzothiazol-2-yl)sulfanyl]ethanamine.
| Compound Name | N-[(7-methoxy-1,3-benzothiazol-2-yl)sulfanyl]ethanamine |
|---|---|
| PubChem CID | 18327053 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-[(7-methoxy-1,3-benzothiazol-2-yl)sulfanyl]ethanamine |
| SMILES | CCNSc1nc2cccc(OC)c2s1 |
| InChI | InChI=1S/C10H12N2OS2/c1-3-11-15-10-12-7-5-4-6-8(13-2)9(7)14-10/h4-6,11H,3H2,1-2H3 |
| InChIKey | XQZJHBUHIASMCN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|