C15H12N2O3S — CID 121004815
phenyl N-(7-methoxy-1,3-benzothiazol-2-yl)carbamate (PubChem CID 121004815) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is phenyl N-(7-methoxy-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | phenyl N-(7-methoxy-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 121004815 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | phenyl N-(7-methoxy-1,3-benzothiazol-2-yl)carbamate |
| SMILES | COc1cccc2nc(NC(=O)Oc3ccccc3)sc12 |
| InChI | InChI=1S/C15H12N2O3S/c1-19-12-9-5-8-11-13(12)21-14(16-11)17-15(18)20-10-6-3-2-4-7-10/h2-9H,1H3,(H,16,17,18) |
| InChIKey | STQDIQMLRCAJOA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |