C13H15N3O2S — CID 162365120
phenyl N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)carbamate (PubChem CID 162365120) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is phenyl N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)carbamate.
| Compound Name | phenyl N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 162365120 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | phenyl N-(3-tert-butyl-1,2,4-thiadiazol-5-yl)carbamate |
| SMILES | CC(C)(C)c1nsc(NC(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N3O2S/c1-13(2,3)10-14-11(19-16-10)15-12(17)18-9-7-5-4-6-8-9/h4-8H,1-3H3,(H,14,15,16,17) |
| InChIKey | OJKOJWGIXBCGOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |