C10H7N3O4S — CID 175751128
5-(phenoxycarbonylamino)-1,2,4-thiadiazole-3-carboxylic acid (PubChem CID 175751128) has the molecular formula C10H7N3O4S and a molecular weight of 265.25 g/mol. Its IUPAC name is 5-(phenoxycarbonylamino)-1,2,4-thiadiazole-3-carboxylic acid.
| Compound Name | 5-(phenoxycarbonylamino)-1,2,4-thiadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 175751128 |
| Molecular Formula | C10H7N3O4S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 5-(phenoxycarbonylamino)-1,2,4-thiadiazole-3-carboxylic acid |
| SMILES | O=C(Nc1nc(C(=O)O)ns1)Oc1ccccc1 |
| InChI | InChI=1S/C10H7N3O4S/c14-8(15)7-11-9(18-13-7)12-10(16)17-6-4-2-1-3-5-6/h1-5H,(H,14,15)(H,11,12,13,16) |
| InChIKey | ZUQRMUVWKHQTBT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |