C11H10N2O2S — CID 23361835
phenyl N-(3-methyl-1,2-thiazol-5-yl)carbamate (PubChem CID 23361835) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is phenyl N-(3-methyl-1,2-thiazol-5-yl)carbamate.
| Compound Name | phenyl N-(3-methyl-1,2-thiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 23361835 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | phenyl N-(3-methyl-1,2-thiazol-5-yl)carbamate |
| SMILES | Cc1cc(NC(=O)Oc2ccccc2)sn1 |
| InChI | InChI=1S/C11H10N2O2S/c1-8-7-10(16-13-8)12-11(14)15-9-5-3-2-4-6-9/h2-7H,1H3,(H,12,14) |
| InChIKey | NDRJEJCOCPGDDA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |