C20H15ClN2O2S — CID 171407865
phenyl N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]carbamate (PubChem CID 171407865) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is phenyl N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | phenyl N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 171407865 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | phenyl N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]carbamate |
| SMILES | C#CC(C)(c1ccc(Cl)cc1)c1csc(NC(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H15ClN2O2S/c1-3-20(2,14-9-11-15(21)12-10-14)17-13-26-18(22-17)23-19(24)25-16-7-5-4-6-8-16/h1,4-13H,2H3,(H,22,23,24) |
| InChIKey | ILEMCBRJADMKMT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|