C14H12BrN3OS — CID 171407714
[4-[2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]urea (PubChem CID 171407714) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is [4-[2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]urea.
| Compound Name | [4-[2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 171407714 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | [4-[2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]urea |
| SMILES | C#CC(C)(c1ccc(Br)cc1)c1csc(NC(N)=O)n1 |
| InChI | InChI=1S/C14H12BrN3OS/c1-3-14(2,9-4-6-10(15)7-5-9)11-8-20-13(17-11)18-12(16)19/h1,4-8H,2H3,(H3,16,17,18,19) |
| InChIKey | DOSZECKMPIEVMN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|