C19H19BrN2O2S — CID 171753832
N-[(S)-[4-[(2S)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]cyclobutanecarboxamide (PubChem CID 171753832) has the molecular formula C19H19BrN2O2S and a molecular weight of 419.34 g/mol. Its IUPAC name is N-[(S)-[4-[(2S)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]cyclobutanecarboxamide.
| Compound Name | N-[(S)-[4-[(2S)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 171753832 |
| Molecular Formula | C19H19BrN2O2S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[(S)-[4-[(2S)-2-(4-bromophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-hydroxymethyl]cyclobutanecarboxamide |
| SMILES | C#C[C@@](C)(c1ccc(Br)cc1)c1csc([C@H](O)NC(=O)C2CCC2)n1 |
| InChI | InChI=1S/C19H19BrN2O2S/c1-3-19(2,13-7-9-14(20)10-8-13)15-11-25-18(21-15)17(24)22-16(23)12-5-4-6-12/h1,7-12,17,24H,4-6H2,2H3,(H,22,23)/t17-,19-/m0/s1 |
| InChIKey | DQXISNFNSFJBFF-HKUYNNGSSA-N |
| XLogP | 3.75 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|