C18H18ClN3O2S — CID 171407717
N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 171407717) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 171407717 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | C#CC(C)(c1ccc(Cl)cc1)c1csc(NC(=O)N2CCC(O)C2)n1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-3-18(2,12-4-6-13(19)7-5-12)15-11-25-16(20-15)21-17(24)22-9-8-14(23)10-22/h1,4-7,11,14,23H,8-10H2,2H3,(H,20,21,24) |
| InChIKey | PRPYUMPBVVHFOP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|