C24H21ClF2N4OS — CID 171407532
N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-3-piperazin-1-ylbenzamide (PubChem CID 171407532) has the molecular formula C24H21ClF2N4OS and a molecular weight of 486.98 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-3-piperazin-1-ylbenzamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-3-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 171407532 |
| Molecular Formula | C24H21ClF2N4OS |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-2,6-difluoro-3-piperazin-1-ylbenzamide |
| SMILES | C#CC(C)(c1ccc(Cl)cc1)c1csc(NC(=O)c2c(F)ccc(N3CCNCC3)c2F)n1 |
| InChI | InChI=1S/C24H21ClF2N4OS/c1-3-24(2,15-4-6-16(25)7-5-15)19-14-33-23(29-19)30-22(32)20-17(26)8-9-18(21(20)27)31-12-10-28-11-13-31/h1,4-9,14,28H,10-13H2,2H3,(H,29,30,32) |
| InChIKey | SRKUODGOQJCRMM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|