C24H28ClN5OS — CID 171407570
1-[4-[2-(4-chlorophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[(4-piperazin-1-ylphenyl)methyl]urea (PubChem CID 171407570) has the molecular formula C24H28ClN5OS and a molecular weight of 470.04 g/mol. Its IUPAC name is 1-[4-[2-(4-chlorophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[(4-piperazin-1-ylphenyl)methyl]urea.
| Compound Name | 1-[4-[2-(4-chlorophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[(4-piperazin-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 171407570 |
| Molecular Formula | C24H28ClN5OS |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1-[4-[2-(4-chlorophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[(4-piperazin-1-ylphenyl)methyl]urea |
| SMILES | CC(C)(c1ccc(Cl)cc1)c1csc(NC(=O)NCc2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C24H28ClN5OS/c1-24(2,18-5-7-19(25)8-6-18)21-16-32-23(28-21)29-22(31)27-15-17-3-9-20(10-4-17)30-13-11-26-12-14-30/h3-10,16,26H,11-15H2,1-2H3,(H2,27,28,29,31) |
| InChIKey | PTNOBHRJTPOSJV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|