C25H30BrN5OS — CID 171407623
1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea (PubChem CID 171407623) has the molecular formula C25H30BrN5OS and a molecular weight of 528.52 g/mol. Its IUPAC name is 1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea.
| Compound Name | 1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 171407623 |
| Molecular Formula | C25H30BrN5OS |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1nc(C(C)(C)c2ccc(Br)cc2)cs1)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C25H30BrN5OS/c1-17(18-4-10-21(11-5-18)31-14-12-27-13-15-31)28-23(32)30-24-29-22(16-33-24)25(2,3)19-6-8-20(26)9-7-19/h4-11,16-17,27H,12-15H2,1-3H3,(H2,28,29,30,32) |
| InChIKey | RVTGHWVTLXHFLL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|