C20H28BrN5OS — CID 171407801
1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-(3-piperazin-1-ylpropyl)urea (PubChem CID 171407801) has the molecular formula C20H28BrN5OS and a molecular weight of 466.45 g/mol. Its IUPAC name is 1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-(3-piperazin-1-ylpropyl)urea.
| Compound Name | 1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-(3-piperazin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 171407801 |
| Molecular Formula | C20H28BrN5OS |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-[4-[2-(4-bromophenyl)propan-2-yl]-1,3-thiazol-2-yl]-3-(3-piperazin-1-ylpropyl)urea |
| SMILES | CC(C)(c1ccc(Br)cc1)c1csc(NC(=O)NCCCN2CCNCC2)n1 |
| InChI | InChI=1S/C20H28BrN5OS/c1-20(2,15-4-6-16(21)7-5-15)17-14-28-19(24-17)25-18(27)23-8-3-11-26-12-9-22-10-13-26/h4-7,14,22H,3,8-13H2,1-2H3,(H2,23,24,25,27) |
| InChIKey | VCLPVOSQCSAOIZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|