C21H30N4O3S — CID 171407867
1-[3-(3-hydroxypyrrolidin-1-yl)propyl]-3-[4-[2-(4-methoxyphenyl)propan-2-yl]-1,3-thiazol-2-yl]urea (PubChem CID 171407867) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 1-[3-(3-hydroxypyrrolidin-1-yl)propyl]-3-[4-[2-(4-methoxyphenyl)propan-2-yl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[3-(3-hydroxypyrrolidin-1-yl)propyl]-3-[4-[2-(4-methoxyphenyl)propan-2-yl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 171407867 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[3-(3-hydroxypyrrolidin-1-yl)propyl]-3-[4-[2-(4-methoxyphenyl)propan-2-yl]-1,3-thiazol-2-yl]urea |
| SMILES | COc1ccc(C(C)(C)c2csc(NC(=O)NCCCN3CCC(O)C3)n2)cc1 |
| InChI | InChI=1S/C21H30N4O3S/c1-21(2,15-5-7-17(28-3)8-6-15)18-14-29-20(23-18)24-19(27)22-10-4-11-25-12-9-16(26)13-25/h5-8,14,16,26H,4,9-13H2,1-3H3,(H2,22,23,24,27) |
| InChIKey | YFYBRSHTZFDLCJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|