C27H31N5OS — CID 175619604
1-[4-[(2S)-2-(4-methylphenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea (PubChem CID 175619604) has the molecular formula C27H31N5OS and a molecular weight of 473.65 g/mol. Its IUPAC name is 1-[4-[(2S)-2-(4-methylphenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea.
| Compound Name | 1-[4-[(2S)-2-(4-methylphenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 175619604 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 1-[4-[(2S)-2-(4-methylphenyl)but-3-yn-2-yl]-1,3-thiazol-2-yl]-3-[1-(4-piperazin-1-ylphenyl)ethyl]urea |
| SMILES | C#C[C@@](C)(c1ccc(C)cc1)c1csc(NC(=O)NC(C)c2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C27H31N5OS/c1-5-27(4,22-10-6-19(2)7-11-22)24-18-34-26(30-24)31-25(33)29-20(3)21-8-12-23(13-9-21)32-16-14-28-15-17-32/h1,6-13,18,20,28H,14-17H2,2-4H3,(H2,29,30,31,33)/t20?,27-/m0/s1 |
| InChIKey | JBBAMHRDXGUISL-OHMHCFLMSA-N |
| XLogP | 4.68 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|