C16H14B2ClN3O2S — CID 175620321
CID 175620321 (PubChem CID 175620321) has the molecular formula C16H14B2ClN3O2S and a molecular weight of 369.45 g/mol.
| Compound Name | CID 175620321 |
|---|---|
| PubChem CID | 175620321 |
| Molecular Formula | C16H14B2ClN3O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)CNC(=O)Nc1nc(C(C)(C#C)c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C16H14B2ClN3O2S/c1-3-15(2,10-4-6-11(19)7-5-10)12-8-25-14(21-12)22-13(23)20-9-16(17,18)24/h1,4-8,24H,9H2,2H3,(H2,20,21,22,23) |
| InChIKey | CUMCWRJIBXPTQS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|