C8H7NO2S — CID 145146192
2-methoxy-1,3-benzothiazol-7-ol (PubChem CID 145146192) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 2-methoxy-1,3-benzothiazol-7-ol.
| Compound Name | 2-methoxy-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 145146192 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 2-methoxy-1,3-benzothiazol-7-ol |
| SMILES | COc1nc2cccc(O)c2s1 |
| InChI | InChI=1S/C8H7NO2S/c1-11-8-9-5-3-2-4-6(10)7(5)12-8/h2-4,10H,1H3 |
| InChIKey | BOYGLDJZNVUUJW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |