About 2-cyclopropyl-1,3-benzothiazol-7-ol
2-cyclopropyl-1,3-benzothiazol-7-ol (PubChem CID 83818047) has the molecular formula C10H9NOS
and a molecular weight of 191.25 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-benzothiazol-7-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-1,3-benzothiazol-7-ol |
| PubChem CID | 83818047 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2-cyclopropyl-1,3-benzothiazol-7-ol |
| SMILES | Oc1cccc2nc(C3CC3)sc12 |
| InChI | InChI=1S/C10H9NOS/c12-8-3-1-2-7-9(8)13-10(11-7)6-4-5-6/h1-3,6,12H,4-5H2 |
| InChIKey | YUPIJGZZKBWKLB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-1,3-benzothiazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,3-benzothiazol-7-ol?
The IUPAC name of 2-cyclopropyl-1,3-benzothiazol-7-ol (CID 83818047) is 2-cyclopropyl-1,3-benzothiazol-7-ol.
What is the SMILES notation for 2-cyclopropyl-1,3-benzothiazol-7-ol?
The canonical SMILES for 2-cyclopropyl-1,3-benzothiazol-7-ol is Oc1cccc2nc(C3CC3)sc12.
What is the InChIKey of 2-cyclopropyl-1,3-benzothiazol-7-ol?
The InChIKey is YUPIJGZZKBWKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS/c12-8-3-1-2-7-9(8)13-10(11-7)6-4-5-6/h1-3,6,12H,4-5H2.
What are the key properties of 2-cyclopropyl-1,3-benzothiazol-7-ol?
2-cyclopropyl-1,3-benzothiazol-7-ol has a molecular weight of 191.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,3-benzothiazol-7-ol is sourced from PubChem (CID 83818047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).