About 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol
2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol (PubChem CID 67275756) has the molecular formula C14H19N3OS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol |
| PubChem CID | 67275756 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol |
| SMILES | CN(C)C1CCN(c2nc3cccc(O)c3s2)CC1 |
| InChI | InChI=1S/C14H19N3OS/c1-16(2)10-6-8-17(9-7-10)14-15-11-4-3-5-12(18)13(11)19-14/h3-5,10,18H,6-9H2,1-2H3 |
| InChIKey | HMSOPVNQWLXOGC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol?
The IUPAC name of 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol (CID 67275756) is 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol.
What is the SMILES notation for 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol?
The canonical SMILES for 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol is CN(C)C1CCN(c2nc3cccc(O)c3s2)CC1.
What is the InChIKey of 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol?
The InChIKey is HMSOPVNQWLXOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS/c1-16(2)10-6-8-17(9-7-10)14-15-11-4-3-5-12(18)13(11)19-14/h3-5,10,18H,6-9H2,1-2H3.
What are the key properties of 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol?
2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol has a molecular weight of 277.39 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)piperidin-1-yl]-1,3-benzothiazol-7-ol is sourced from PubChem (CID 67275756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).