C13H16N2O2S2 — CID 154736461
7-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)-1,3-benzothiazole (PubChem CID 154736461) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 7-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)-1,3-benzothiazole.
| Compound Name | 7-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 154736461 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 7-methyl-2-(3-methylsulfonylpyrrolidin-1-yl)-1,3-benzothiazole |
| SMILES | Cc1cccc2nc(N3CCC(S(C)(=O)=O)C3)sc12 |
| InChI | InChI=1S/C13H16N2O2S2/c1-9-4-3-5-11-12(9)18-13(14-11)15-7-6-10(8-15)19(2,16)17/h3-5,10H,6-8H2,1-2H3 |
| InChIKey | SYVBJSQOSLJLQT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |