C15H13ClN2O2S — CID 61071902
4-[2-amino-2-(7-chloro-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol (PubChem CID 61071902) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 4-[2-amino-2-(7-chloro-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-amino-2-(7-chloro-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61071902 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-[2-amino-2-(7-chloro-1,3-benzothiazol-2-yl)ethyl]benzene-1,2-diol |
| SMILES | NC(Cc1ccc(O)c(O)c1)c1nc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C15H13ClN2O2S/c16-9-2-1-3-11-14(9)21-15(18-11)10(17)6-8-4-5-12(19)13(20)7-8/h1-5,7,10,19-20H,6,17H2 |
| InChIKey | IUSOSMOTBCLYFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|