C14H12Cl3N — CID 55139269
1-(3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine (PubChem CID 55139269) has the molecular formula C14H12Cl3N and a molecular weight of 300.62 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine.
| Compound Name | 1-(3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 55139269 |
| Molecular Formula | C14H12Cl3N |
| Molecular Weight | 300.62 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(Cl)c(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12Cl3N/c15-11-3-1-2-10(8-11)14(18)7-9-4-5-12(16)13(17)6-9/h1-6,8,14H,7,18H2 |
| InChIKey | PWXFNMOQSUBAFR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |