C14H11BrCl3N — CID 81296108
1-(4-bromo-3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine (PubChem CID 81296108) has the molecular formula C14H11BrCl3N and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 81296108 |
| Molecular Formula | C14H11BrCl3N |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-2-(3,4-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1ccc(Cl)c(Cl)c1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C14H11BrCl3N/c15-10-3-2-9(7-12(10)17)14(19)6-8-1-4-11(16)13(18)5-8/h1-5,7,14H,6,19H2 |
| InChIKey | BVXCQTYEIKVTLY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |