C11H15N5O2 — CID 113432049
4-[2-amino-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diol (PubChem CID 113432049) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[2-amino-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-amino-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 113432049 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-[2-amino-2-(5-amino-1-methyl-1,2,4-triazol-3-yl)ethyl]benzene-1,2-diol |
| SMILES | Cn1nc(C(N)Cc2ccc(O)c(O)c2)nc1N |
| InChI | InChI=1S/C11H15N5O2/c1-16-11(13)14-10(15-16)7(12)4-6-2-3-8(17)9(18)5-6/h2-3,5,7,17-18H,4,12H2,1H3,(H2,13,14,15) |
| InChIKey | XATNIHQXWPSFQY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|