C13H15N3O5 — CID 115970588
ethyl 5-[1-amino-2-(3,4-dihydroxyphenyl)ethyl]-1,2,4-oxadiazole-3-carboxylate (PubChem CID 115970588) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is ethyl 5-[1-amino-2-(3,4-dihydroxyphenyl)ethyl]-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | ethyl 5-[1-amino-2-(3,4-dihydroxyphenyl)ethyl]-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 115970588 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | ethyl 5-[1-amino-2-(3,4-dihydroxyphenyl)ethyl]-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(C(N)Cc2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C13H15N3O5/c1-2-20-13(19)11-15-12(21-16-11)8(14)5-7-3-4-9(17)10(18)6-7/h3-4,6,8,17-18H,2,5,14H2,1H3 |
| InChIKey | PEYGFHKXLIPTDP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|