C9H13N3O3 — CID 112631677
ethyl 5-(1-aminobut-3-enyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 112631677) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 5-(1-aminobut-3-enyl)-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | ethyl 5-(1-aminobut-3-enyl)-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 112631677 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | ethyl 5-(1-aminobut-3-enyl)-1,2,4-oxadiazole-3-carboxylate |
| SMILES | C=CCC(N)c1nc(C(=O)OCC)no1 |
| InChI | InChI=1S/C9H13N3O3/c1-3-5-6(10)8-11-7(12-15-8)9(13)14-4-2/h3,6H,1,4-5,10H2,2H3 |
| InChIKey | YUWFWLQAMGETAH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|