C11H15N3S — CID 82191548
N'-(4,7-dimethyl-1,3-benzothiazol-2-yl)ethane-1,2-diamine (PubChem CID 82191548) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N'-(4,7-dimethyl-1,3-benzothiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(4,7-dimethyl-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82191548 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N'-(4,7-dimethyl-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
| SMILES | Cc1ccc(C)c2sc(NCCN)nc12 |
| InChI | InChI=1S/C11H15N3S/c1-7-3-4-8(2)10-9(7)14-11(15-10)13-6-5-12/h3-4H,5-6,12H2,1-2H3,(H,13,14) |
| InChIKey | UQZQNXLDGSZWEK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |