C11H21N3S — CID 107844668
N'-(4,5-dimethyl-1,3-thiazol-2-yl)hexane-1,6-diamine (PubChem CID 107844668) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is N'-(4,5-dimethyl-1,3-thiazol-2-yl)hexane-1,6-diamine.
| Compound Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 107844668 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)hexane-1,6-diamine |
| SMILES | Cc1nc(NCCCCCCN)sc1C |
| InChI | InChI=1S/C11H21N3S/c1-9-10(2)15-11(14-9)13-8-6-4-3-5-7-12/h3-8,12H2,1-2H3,(H,13,14) |
| InChIKey | IVMYFZLNEQCQEP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|