C13H19Cl2N3S — CID 18948824
N'-(5-methyl-4-phenyl-1,3-thiazol-2-yl)propane-1,3-diamine;dihydrochloride (PubChem CID 18948824) has the molecular formula C13H19Cl2N3S and a molecular weight of 320.29 g/mol. Its IUPAC name is N'-(5-methyl-4-phenyl-1,3-thiazol-2-yl)propane-1,3-diamine;dihydrochloride.
| Compound Name | N'-(5-methyl-4-phenyl-1,3-thiazol-2-yl)propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18948824 |
| Molecular Formula | C13H19Cl2N3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N'-(5-methyl-4-phenyl-1,3-thiazol-2-yl)propane-1,3-diamine;dihydrochloride |
| SMILES | Cc1sc(NCCCN)nc1-c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C13H17N3S.2ClH/c1-10-12(11-6-3-2-4-7-11)16-13(17-10)15-9-5-8-14;;/h2-4,6-7H,5,8-9,14H2,1H3,(H,15,16);2*1H |
| InChIKey | VKUOZEVVEAWLNF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|