C16H22N2O2S — CID 52794394
N-butyl-4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 52794394) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-butyl-4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | N-butyl-4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 52794394 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-butyl-4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCNc1nc(-c2ccc(OC)c(OC)c2)c(C)s1 |
| InChI | InChI=1S/C16H22N2O2S/c1-5-6-9-17-16-18-15(11(2)21-16)12-7-8-13(19-3)14(10-12)20-4/h7-8,10H,5-6,9H2,1-4H3,(H,17,18) |
| InChIKey | VDIKVLSYYINVCB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|