C21H24N2O3S — CID 4275057
2-[[[4-(3,4-dimethoxyphenyl)-5-propyl-1,3-thiazol-2-yl]amino]methyl]phenol (PubChem CID 4275057) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[[[4-(3,4-dimethoxyphenyl)-5-propyl-1,3-thiazol-2-yl]amino]methyl]phenol.
| Compound Name | 2-[[[4-(3,4-dimethoxyphenyl)-5-propyl-1,3-thiazol-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 4275057 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[[[4-(3,4-dimethoxyphenyl)-5-propyl-1,3-thiazol-2-yl]amino]methyl]phenol |
| SMILES | CCCc1sc(NCc2ccccc2O)nc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-4-7-19-20(14-10-11-17(25-2)18(12-14)26-3)23-21(27-19)22-13-15-8-5-6-9-16(15)24/h5-6,8-12,24H,4,7,13H2,1-3H3,(H,22,23) |
| InChIKey | XVSIXJLQRZHTFI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|