C20H20N2O2S — CID 1111717
methyl 4-[(4-phenyl-5-propyl-1,3-thiazol-2-yl)amino]benzoate (PubChem CID 1111717) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is methyl 4-[(4-phenyl-5-propyl-1,3-thiazol-2-yl)amino]benzoate.
| Compound Name | methyl 4-[(4-phenyl-5-propyl-1,3-thiazol-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 1111717 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | methyl 4-[(4-phenyl-5-propyl-1,3-thiazol-2-yl)amino]benzoate |
| SMILES | CCCc1sc(Nc2ccc(C(=O)OC)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-3-7-17-18(14-8-5-4-6-9-14)22-20(25-17)21-16-12-10-15(11-13-16)19(23)24-2/h4-6,8-13H,3,7H2,1-2H3,(H,21,22) |
| InChIKey | WIUMYBQBAJVRLN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |