C29H30N2OS — CID 4061770
4-tert-butyl-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide (PubChem CID 4061770) has the molecular formula C29H30N2OS and a molecular weight of 454.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4061770 |
| Molecular Formula | C29H30N2OS |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-tert-butyl-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCc1sc(NC(=O)c2ccc(C(C)(C)C)cc2)nc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2OS/c1-5-9-25-26(22-14-12-21(13-15-22)20-10-7-6-8-11-20)30-28(33-25)31-27(32)23-16-18-24(19-17-23)29(2,3)4/h6-8,10-19H,5,9H2,1-4H3,(H,30,31,32) |
| InChIKey | VGOXNGJJBXUXRM-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |