C25H20Cl2N2OS — CID 5013046
2,4-dichloro-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide (PubChem CID 5013046) has the molecular formula C25H20Cl2N2OS and a molecular weight of 467.42 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5013046 |
| Molecular Formula | C25H20Cl2N2OS |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2,4-dichloro-N-[4-(4-phenylphenyl)-5-propyl-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCc1sc(NC(=O)c2ccc(Cl)cc2Cl)nc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20Cl2N2OS/c1-2-6-22-23(18-11-9-17(10-12-18)16-7-4-3-5-8-16)28-25(31-22)29-24(30)20-14-13-19(26)15-21(20)27/h3-5,7-15H,2,6H2,1H3,(H,28,29,30) |
| InChIKey | GFBVOFNYPUFLML-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |