C21H21N2O5S- — CID 7327070
2-[4-(3,4-dimethoxyphenyl)-2-(2-ethoxyanilino)-1,3-thiazol-5-yl]acetate (PubChem CID 7327070) has the molecular formula C21H21N2O5S- and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-2-(2-ethoxyanilino)-1,3-thiazol-5-yl]acetate.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-2-(2-ethoxyanilino)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 7327070 |
| Molecular Formula | C21H21N2O5S- |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-2-(2-ethoxyanilino)-1,3-thiazol-5-yl]acetate |
| SMILES | CCOc1ccccc1Nc1nc(-c2ccc(OC)c(OC)c2)c(CC(=O)[O-])s1 |
| InChI | InChI=1S/C21H22N2O5S/c1-4-28-15-8-6-5-7-14(15)22-21-23-20(18(29-21)12-19(24)25)13-9-10-16(26-2)17(11-13)27-3/h5-11H,4,12H2,1-3H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | KTNZOIJMVVNKKJ-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |