C19H16FN2O4S- — CID 7460137
2-[4-(2,5-dimethoxyphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetate (PubChem CID 7460137) has the molecular formula C19H16FN2O4S- and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-[4-(2,5-dimethoxyphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetate.
| Compound Name | 2-[4-(2,5-dimethoxyphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 7460137 |
| Molecular Formula | C19H16FN2O4S- |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[4-(2,5-dimethoxyphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetate |
| SMILES | COc1ccc(OC)c(-c2nc(Nc3ccccc3F)sc2CC(=O)[O-])c1 |
| InChI | InChI=1S/C19H17FN2O4S/c1-25-11-7-8-15(26-2)12(9-11)18-16(10-17(23)24)27-19(22-18)21-14-6-4-3-5-13(14)20/h3-9H,10H2,1-2H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | OXOBCJRBKXIDPF-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |