C22H27N5O2S — CID 108810237
4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]butanamide (PubChem CID 108810237) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108810237 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1ccc(-c2nc(NC(=O)CCCNc3nc(C)cc(C)n3)sc2C)cc1C |
| InChI | InChI=1S/C22H27N5O2S/c1-13-11-17(8-9-18(13)29-5)20-16(4)30-22(27-20)26-19(28)7-6-10-23-21-24-14(2)12-15(3)25-21/h8-9,11-12H,6-7,10H2,1-5H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | DLBDDYIGXLNNIH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|