C14H13Cl3N2O2S — CID 108738227
2,2,2-trichloro-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 108738227) has the molecular formula C14H13Cl3N2O2S and a molecular weight of 379.70 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 108738227 |
| Molecular Formula | C14H13Cl3N2O2S |
| Molecular Weight | 379.70 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2nc(NC(=O)C(Cl)(Cl)Cl)sc2C)cc1C |
| InChI | InChI=1S/C14H13Cl3N2O2S/c1-7-6-9(4-5-10(7)21-3)11-8(2)22-13(18-11)19-12(20)14(15,16)17/h4-6H,1-3H3,(H,18,19,20) |
| InChIKey | PQNOFDYSAJLJMF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|