C14H18N2O3S — CID 39403548
O-[2-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]hydroxylamine (PubChem CID 39403548) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is O-[2-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]hydroxylamine.
| Compound Name | O-[2-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 39403548 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | O-[2-[4-(3,4-dimethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]hydroxylamine |
| SMILES | COc1ccc(-c2nc(CCON)sc2C)cc1OC |
| InChI | InChI=1S/C14H18N2O3S/c1-9-14(16-13(20-9)6-7-19-15)10-4-5-11(17-2)12(8-10)18-3/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | DPZIKFIMRJZTPE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|