C16H20N2OS — CID 39390793
O-[2-[5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]ethyl]hydroxylamine (PubChem CID 39390793) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is O-[2-[5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]ethyl]hydroxylamine.
| Compound Name | O-[2-[5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 39390793 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | O-[2-[5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]ethyl]hydroxylamine |
| SMILES | Cc1sc(CCON)nc1-c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H20N2OS/c1-11-16(18-15(20-11)8-9-19-17)14-7-6-12-4-2-3-5-13(12)10-14/h6-7,10H,2-5,8-9,17H2,1H3 |
| InChIKey | BQVMCSABQJCHLS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|