C13H14N2S — CID 8878238
4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine (PubChem CID 8878238) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8878238 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yl)-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1sc(N)nc1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H14N2S/c1-8-12(15-13(14)16-8)11-6-5-9-3-2-4-10(9)7-11/h5-7H,2-4H2,1H3,(H2,14,15) |
| InChIKey | PIHSKMPOPWHJCA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiazole_amine_B(3)', 'substructure': 'N/A'} |
|---|