C14H17N3S — CID 82049669
[5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 82049669) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is [5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 82049669 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | [5-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1sc(NN)nc1-c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H17N3S/c1-9-13(16-14(17-15)18-9)12-7-6-10-4-2-3-5-11(10)8-12/h6-8H,2-5,15H2,1H3,(H,16,17) |
| InChIKey | VCJQDJLLQSPILI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|