C15H16ClNS — CID 93189973
5-(2-chloroethyl)-4-(2,3-dihydro-1H-inden-5-yl)-2-methyl-1,3-thiazole (PubChem CID 93189973) has the molecular formula C15H16ClNS and a molecular weight of 277.82 g/mol. Its IUPAC name is 5-(2-chloroethyl)-4-(2,3-dihydro-1H-inden-5-yl)-2-methyl-1,3-thiazole.
| Compound Name | 5-(2-chloroethyl)-4-(2,3-dihydro-1H-inden-5-yl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 93189973 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-(2-chloroethyl)-4-(2,3-dihydro-1H-inden-5-yl)-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc3c(c2)CCC3)c(CCCl)s1 |
| InChI | InChI=1S/C15H16ClNS/c1-10-17-15(14(18-10)7-8-16)13-6-5-11-3-2-4-12(11)9-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | HBLFVAGWOGWKQB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|