C15H19NS — CID 5020924
4-(3,4-dimethylphenyl)-2-methyl-5-propyl-1,3-thiazole (PubChem CID 5020924) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2-methyl-5-propyl-1,3-thiazole.
| Compound Name | 4-(3,4-dimethylphenyl)-2-methyl-5-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 5020924 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2-methyl-5-propyl-1,3-thiazole |
| SMILES | CCCc1sc(C)nc1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H19NS/c1-5-6-14-15(16-12(4)17-14)13-8-7-10(2)11(3)9-13/h7-9H,5-6H2,1-4H3 |
| InChIKey | NWASCGUNDOUHHU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |