C8H13N3O2S — CID 83204866
2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethyl carbamate (PubChem CID 83204866) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethyl carbamate.
| Compound Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83204866 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]ethyl carbamate |
| SMILES | Cc1nc(NCCOC(N)=O)sc1C |
| InChI | InChI=1S/C8H13N3O2S/c1-5-6(2)14-8(11-5)10-3-4-13-7(9)12/h3-4H2,1-2H3,(H2,9,12)(H,10,11) |
| InChIKey | ZJUYNYPGUXAJJD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|