About 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine
4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine (PubChem CID 65169271) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine |
| PubChem CID | 65169271 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NCCc2ccncc2)sc1C |
| InChI | InChI=1S/C12H15N3S/c1-9-10(2)16-12(15-9)14-8-5-11-3-6-13-7-4-11/h3-4,6-7H,5,8H2,1-2H3,(H,14,15) |
| InChIKey | XRZAOVJDIFOCLV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine?
The IUPAC name of 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine (CID 65169271) is 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine is Cc1nc(NCCc2ccncc2)sc1C.
What is the InChIKey of 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine?
The InChIKey is XRZAOVJDIFOCLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c1-9-10(2)16-12(15-9)14-8-5-11-3-6-13-7-4-11/h3-4,6-7H,5,8H2,1-2H3,(H,14,15).
What are the key properties of 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine?
4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine has a molecular weight of 233.34 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-(2-pyridin-4-ylethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 65169271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).