C7H4ClIN2S — CID 146273761
7-chloro-4-iodo-1,3-benzothiazol-2-amine (PubChem CID 146273761) has the molecular formula C7H4ClIN2S and a molecular weight of 310.55 g/mol. Its IUPAC name is 7-chloro-4-iodo-1,3-benzothiazol-2-amine.
| Compound Name | 7-chloro-4-iodo-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 146273761 |
| Molecular Formula | C7H4ClIN2S |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 309.88 |
| IUPAC Name | 7-chloro-4-iodo-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(I)ccc(Cl)c2s1 |
| InChI | InChI=1S/C7H4ClIN2S/c8-3-1-2-4(9)5-6(3)12-7(10)11-5/h1-2H,(H2,10,11) |
| InChIKey | WSEWDULMOFKAQG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|