C8H8N2OS — CID 171560062
2-amino-4-methyl-1,3-benzothiazol-7-ol (PubChem CID 171560062) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-amino-4-methyl-1,3-benzothiazol-7-ol.
| Compound Name | 2-amino-4-methyl-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 171560062 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-amino-4-methyl-1,3-benzothiazol-7-ol |
| SMILES | Cc1ccc(O)c2sc(N)nc12 |
| InChI | InChI=1S/C8H8N2OS/c1-4-2-3-5(11)7-6(4)10-8(9)12-7/h2-3,11H,1H3,(H2,9,10) |
| InChIKey | KDTRPLBIPYWQBA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |